Immediate Impact
3 from Science/Nature 55 standout
Citing Papers
Relaxor Antiferroelectric Dynamics for Neuromorphic Computing
2025 Standout
Ultra-high temperature ceramics for extreme environments
2023 Standout
Works of Y. Tachi being referenced
Temperature-Field Phase Diagrams in Pb(Mg1/3Nb2/3)O3-29.5%PbTiO3
2014
Relation between macroscopic length change and the crystal structure in heavily neutron-irradiated ceramics
2004
Author Peers
| Author | Last Decade | Papers | Cites | ||||
|---|---|---|---|---|---|---|---|
| Y. Tachi | 320 | 111 | 130 | 114 | 31 | 441 | |
| Κ. A. Keller | 176 | 42 | 189 | 72 | 31 | 439 | |
| S.M. González de Vicente | 289 | 70 | 253 | 97 | 25 | 493 | |
| Yu Zhao | 219 | 50 | 99 | 162 | 28 | 406 | |
| Kaijie Ning | 304 | 25 | 192 | 176 | 51 | 431 | |
| Peter Karduck | 321 | 60 | 34 | 71 | 37 | 477 | |
| Shin‐ichi Matsuda | 226 | 44 | 154 | 103 | 39 | 382 | |
| S. Pellegrino | 360 | 44 | 75 | 69 | 21 | 483 | |
| G. Le Marois | 264 | 93 | 117 | 64 | 26 | 387 | |
| Kongfang Wei | 381 | 79 | 41 | 93 | 43 | 475 | |
| G. Pfeiffer | 343 | 22 | 98 | 203 | 28 | 494 |
All Works
Loading papers...