Immediate Impact
2 by Nobel laureates 10 from Science/Nature 98 standout
Citing Papers
Biodegradable ferroelectric molecular crystal with large piezoelectric response
2024 StandoutScience
Computational chemistry for water-splitting electrocatalysis
2024 Standout
Works of K. Fujishiro being referenced
Universal phase diagram for high-piezoelectric perovskite systems
2001
Structural and optical studies of development of the long-range order in ferroelectric relaxor Pb(Zn1/3Nb2/3)O3/9%PbTiO3
1998
Author Peers
| Author | Last Decade | Papers | Cites | ||||
|---|---|---|---|---|---|---|---|
| K. Fujishiro | 311 | 189 | 11 | 178 | 7 | 345 | |
| Lisa Eurenius | 185 | 104 | 7 | 143 | 7 | 399 | |
| Karla Lienau | 262 | 94 | 13 | 99 | 9 | 397 | |
| Shengming Guo | 206 | 178 | 14 | 107 | 11 | 373 | |
| H. Kawamoto | 292 | 51 | 17 | 73 | 9 | 349 | |
| Alison F. Smith | 158 | 149 | 35 | 185 | 7 | 374 | |
| Ming-Shien Hu | 220 | 170 | 14 | 140 | 7 | 364 | |
| Seong‐Ran Jeon | 252 | 128 | 6 | 119 | 14 | 369 | |
| Eissa Al-Nasrallah | 224 | 54 | 16 | 126 | 5 | 303 | |
| Brandon C. Marin | 124 | 102 | 18 | 248 | 9 | 376 | |
| Naveen K. Mahenderkar | 195 | 89 | 6 | 103 | 4 | 358 |
All Works
Loading papers...