Bryan D. Steffey

Designing for a green chemistry future

Using nature’s blueprint to expand catalysis with Earth-abundant metals

Electrochemical Reduction of CO2 Catalyzed by a Dinuclear Palladium Complex Containing a Bridging Hexaphosphine Ligand: Evidence for Cooperativity

Reduction of the heterobimetallic .mu.-.eta.1(C):.eta.2(O,O')-CO2 complex Cp(CO)2Ru(CO2)Zr(Cl)Cp2 to its .mu.-.eta.1(C):.eta.1(O)-formaldehyde derivative Cp(CO)2Ru(CH2O)Zr(Cl)Cp2: hydride transfer occurs at ligated carbon monoxide